C22H28BCl2N3O6 — CID 156688041
2,5-dichloro-N-[2-[[(1R)-3-methyl-1-[(1R,7R)-11-methyl-2,6-dioxo-3,5-dioxa-11-azonia-4-boranuidatricyclo[5.3.1.04,11]undecan-4-yl]butyl]amino]-2-oxoethyl]benzamide (PubChem CID 156688041) has the molecular formula C22H28BCl2N3O6 and a molecular weight of 512.20 g/mol. Its IUPAC name is 2,5-dichloro-N-[2-[[(1R)-3-methyl-1-[(1R,7R)-11-methyl-2,6-dioxo-3,5-dioxa-11-azonia-4-boranuidatricyclo[5.3.1.04,11]undecan-4-yl]butyl]amino]-2-oxoethyl]benzamide.
| Compound Name | 2,5-dichloro-N-[2-[[(1R)-3-methyl-1-[(1R,7R)-11-methyl-2,6-dioxo-3,5-dioxa-11-azonia-4-boranuidatricyclo[5.3.1.04,11]undecan-4-yl]butyl]amino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 156688041 |
| Molecular Formula | C22H28BCl2N3O6 |
| Molecular Weight | 512.20 g/mol |
| Exact Mass | 511.14 |
| IUPAC Name | 2,5-dichloro-N-[2-[[(1R)-3-methyl-1-[(1R,7R)-11-methyl-2,6-dioxo-3,5-dioxa-11-azonia-4-boranuidatricyclo[5.3.1.04,11]undecan-4-yl]butyl]amino]-2-oxoethyl]benzamide |
| SMILES | CC(C)C[C@H](NC(=O)CNC(=O)c1cc(Cl)ccc1Cl)[B-]12OC(=O)[C@H]3CCC[C@H](C(=O)O1)[N+]32C |
| InChI | InChI=1S/C22H28BCl2N3O6/c1-12(2)9-18(27-19(29)11-26-20(30)14-10-13(24)7-8-15(14)25)23-28(3)16(21(31)33-23)5-4-6-17(28)22(32)34-23/h7-8,10,12,16-18H,4-6,9,11H2,1-3H3,(H,26,30)(H,27,29)/t16-,17-,18+,23?,28?/m1/s1 |
| InChIKey | RGDHEFMBBASBHL-SIERSRBESA-N |
| XLogP | 2.21 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.20 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|