C20H27BCl2N2O5S — CID 140759242
2,5-dichloro-N-[2-[[(1R)-1-[(5S,7R)-5,7-dimethyl-4-oxo-1,3,6,2-dioxathiaborocan-2-yl]-3-methylbutyl]amino]-2-oxoethyl]benzamide (PubChem CID 140759242) has the molecular formula C20H27BCl2N2O5S and a molecular weight of 489.23 g/mol. Its IUPAC name is 2,5-dichloro-N-[2-[[(1R)-1-[(5S,7R)-5,7-dimethyl-4-oxo-1,3,6,2-dioxathiaborocan-2-yl]-3-methylbutyl]amino]-2-oxoethyl]benzamide.
| Compound Name | 2,5-dichloro-N-[2-[[(1R)-1-[(5S,7R)-5,7-dimethyl-4-oxo-1,3,6,2-dioxathiaborocan-2-yl]-3-methylbutyl]amino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 140759242 |
| Molecular Formula | C20H27BCl2N2O5S |
| Molecular Weight | 489.23 g/mol |
| Exact Mass | 488.11 |
| IUPAC Name | 2,5-dichloro-N-[2-[[(1R)-1-[(5S,7R)-5,7-dimethyl-4-oxo-1,3,6,2-dioxathiaborocan-2-yl]-3-methylbutyl]amino]-2-oxoethyl]benzamide |
| SMILES | CC(C)C[C@H](NC(=O)CNC(=O)c1cc(Cl)ccc1Cl)B1OC[C@@H](C)S[C@@H](C)C(=O)O1 |
| InChI | InChI=1S/C20H27BCl2N2O5S/c1-11(2)7-17(21-29-10-12(3)31-13(4)20(28)30-21)25-18(26)9-24-19(27)15-8-14(22)5-6-16(15)23/h5-6,8,11-13,17H,7,9-10H2,1-4H3,(H,24,27)(H,25,26)/t12-,13+,17+/m1/s1 |
| InChIKey | DDZZPUFCUJGNPY-IGCXYCKISA-N |
| XLogP | 3.37 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.23 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|