C21H28BCl2NO5S — CID 159555630
2,5-dichloro-N-[(4R)-4-[(5R,7R)-5,7-dimethyl-4-oxo-1,3,6,2-dioxathiaborocan-2-yl]-6-methyl-2-oxoheptyl]benzamide (PubChem CID 159555630) has the molecular formula C21H28BCl2NO5S and a molecular weight of 488.24 g/mol. Its IUPAC name is 2,5-dichloro-N-[(4R)-4-[(5R,7R)-5,7-dimethyl-4-oxo-1,3,6,2-dioxathiaborocan-2-yl]-6-methyl-2-oxoheptyl]benzamide.
| Compound Name | 2,5-dichloro-N-[(4R)-4-[(5R,7R)-5,7-dimethyl-4-oxo-1,3,6,2-dioxathiaborocan-2-yl]-6-methyl-2-oxoheptyl]benzamide |
|---|---|
| PubChem CID | 159555630 |
| Molecular Formula | C21H28BCl2NO5S |
| Molecular Weight | 488.24 g/mol |
| Exact Mass | 487.12 |
| IUPAC Name | 2,5-dichloro-N-[(4R)-4-[(5R,7R)-5,7-dimethyl-4-oxo-1,3,6,2-dioxathiaborocan-2-yl]-6-methyl-2-oxoheptyl]benzamide |
| SMILES | CC(C)C[C@H](CC(=O)CNC(=O)c1cc(Cl)ccc1Cl)B1OC[C@@H](C)S[C@H](C)C(=O)O1 |
| InChI | InChI=1S/C21H28BCl2NO5S/c1-12(2)7-15(22-29-11-13(3)31-14(4)21(28)30-22)8-17(26)10-25-20(27)18-9-16(23)5-6-19(18)24/h5-6,9,12-15H,7-8,10-11H2,1-4H3,(H,25,27)/t13-,14-,15-/m1/s1 |
| InChIKey | MFYJERBKTXZKFB-RBSFLKMASA-N |
| XLogP | 4.67 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.24 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|