C24H32BCl2NO6 — CID 159630149
2,5-dichloro-N-[(4R)-4-[(4R)-4-(3,3-dimethylbutanoyl)-6-oxo-1,3,2-dioxaborinan-2-yl]-6-methyl-2-oxoheptyl]benzamide (PubChem CID 159630149) has the molecular formula C24H32BCl2NO6 and a molecular weight of 512.24 g/mol. Its IUPAC name is 2,5-dichloro-N-[(4R)-4-[(4R)-4-(3,3-dimethylbutanoyl)-6-oxo-1,3,2-dioxaborinan-2-yl]-6-methyl-2-oxoheptyl]benzamide.
| Compound Name | 2,5-dichloro-N-[(4R)-4-[(4R)-4-(3,3-dimethylbutanoyl)-6-oxo-1,3,2-dioxaborinan-2-yl]-6-methyl-2-oxoheptyl]benzamide |
|---|---|
| PubChem CID | 159630149 |
| Molecular Formula | C24H32BCl2NO6 |
| Molecular Weight | 512.24 g/mol |
| Exact Mass | 511.17 |
| IUPAC Name | 2,5-dichloro-N-[(4R)-4-[(4R)-4-(3,3-dimethylbutanoyl)-6-oxo-1,3,2-dioxaborinan-2-yl]-6-methyl-2-oxoheptyl]benzamide |
| SMILES | CC(C)C[C@H](CC(=O)CNC(=O)c1cc(Cl)ccc1Cl)B1OC(=O)C[C@H](C(=O)CC(C)(C)C)O1 |
| InChI | InChI=1S/C24H32BCl2NO6/c1-14(2)8-15(25-33-21(11-22(31)34-25)20(30)12-24(3,4)5)9-17(29)13-28-23(32)18-10-16(26)6-7-19(18)27/h6-7,10,14-15,21H,8-9,11-13H2,1-5H3,(H,28,32)/t15-,21-/m1/s1 |
| InChIKey | MOZZTSUQVPEKNA-QVKFZJNVSA-N |
| XLogP | 4.92 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.24 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|