C25H34BCl2NO4 — CID 160939365
2,5-dichloro-N-[(4R)-6-methyl-2-oxo-4-[(1S,2R,6S,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]heptyl]benzamide (PubChem CID 160939365) has the molecular formula C25H34BCl2NO4 and a molecular weight of 494.27 g/mol. Its IUPAC name is 2,5-dichloro-N-[(4R)-6-methyl-2-oxo-4-[(1S,2R,6S,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]heptyl]benzamide.
| Compound Name | 2,5-dichloro-N-[(4R)-6-methyl-2-oxo-4-[(1S,2R,6S,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]heptyl]benzamide |
|---|---|
| PubChem CID | 160939365 |
| Molecular Formula | C25H34BCl2NO4 |
| Molecular Weight | 494.27 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | 2,5-dichloro-N-[(4R)-6-methyl-2-oxo-4-[(1S,2R,6S,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]heptyl]benzamide |
| SMILES | CC(C)C[C@H](CC(=O)CNC(=O)c1cc(Cl)ccc1Cl)B1O[C@H]2C[C@@H]3C[C@@H](C3(C)C)[C@@]2(C)O1 |
| InChI | InChI=1S/C25H34BCl2NO4/c1-14(2)8-16(11-18(30)13-29-23(31)19-12-17(27)6-7-20(19)28)26-32-22-10-15-9-21(24(15,3)4)25(22,5)33-26/h6-7,12,14-16,21-22H,8-11,13H2,1-5H3,(H,29,31)/t15-,16+,21-,22-,25+/m0/s1 |
| InChIKey | NWECHKLCBBTJGN-QNGQWBDISA-N |
| XLogP | 5.83 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.27 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|