C19H24BCl2NO5S — CID 162240363
2,5-dichloro-N-[(4R)-6-methyl-2-oxo-4-(4-oxo-1,3,6,2-dioxathiaborocan-2-yl)heptyl]benzamide (PubChem CID 162240363) has the molecular formula C19H24BCl2NO5S and a molecular weight of 460.19 g/mol. Its IUPAC name is 2,5-dichloro-N-[(4R)-6-methyl-2-oxo-4-(4-oxo-1,3,6,2-dioxathiaborocan-2-yl)heptyl]benzamide.
| Compound Name | 2,5-dichloro-N-[(4R)-6-methyl-2-oxo-4-(4-oxo-1,3,6,2-dioxathiaborocan-2-yl)heptyl]benzamide |
|---|---|
| PubChem CID | 162240363 |
| Molecular Formula | C19H24BCl2NO5S |
| Molecular Weight | 460.19 g/mol |
| Exact Mass | 459.08 |
| IUPAC Name | 2,5-dichloro-N-[(4R)-6-methyl-2-oxo-4-(4-oxo-1,3,6,2-dioxathiaborocan-2-yl)heptyl]benzamide |
| SMILES | CC(C)C[C@H](CC(=O)CNC(=O)c1cc(Cl)ccc1Cl)B1OCCSCC(=O)O1 |
| InChI | InChI=1S/C19H24BCl2NO5S/c1-12(2)7-13(20-27-5-6-29-11-18(25)28-20)8-15(24)10-23-19(26)16-9-14(21)3-4-17(16)22/h3-4,9,12-13H,5-8,10-11H2,1-2H3,(H,23,26)/t13-/m1/s1 |
| InChIKey | ZWPRHMAWEDXULJ-CYBMUJFWSA-N |
| XLogP | 3.89 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.19 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|