C22H26BCl2NO8 — CID 157152029
2-[2-[(4R)-1-[(2,5-dichlorobenzoyl)amino]-6-methyl-2-oxoheptan-4-yl]-4-(2-hydroxyprop-2-enyl)-5-oxo-1,3,2-dioxaborolan-4-yl]acetic acid (PubChem CID 157152029) has the molecular formula C22H26BCl2NO8 and a molecular weight of 514.17 g/mol. Its IUPAC name is 2-[2-[(4R)-1-[(2,5-dichlorobenzoyl)amino]-6-methyl-2-oxoheptan-4-yl]-4-(2-hydroxyprop-2-enyl)-5-oxo-1,3,2-dioxaborolan-4-yl]acetic acid.
| Compound Name | 2-[2-[(4R)-1-[(2,5-dichlorobenzoyl)amino]-6-methyl-2-oxoheptan-4-yl]-4-(2-hydroxyprop-2-enyl)-5-oxo-1,3,2-dioxaborolan-4-yl]acetic acid |
|---|---|
| PubChem CID | 157152029 |
| Molecular Formula | C22H26BCl2NO8 |
| Molecular Weight | 514.17 g/mol |
| Exact Mass | 513.11 |
| IUPAC Name | 2-[2-[(4R)-1-[(2,5-dichlorobenzoyl)amino]-6-methyl-2-oxoheptan-4-yl]-4-(2-hydroxyprop-2-enyl)-5-oxo-1,3,2-dioxaborolan-4-yl]acetic acid |
| SMILES | C=C(O)CC1(CC(=O)O)OB([C@@H](CC(=O)CNC(=O)c2cc(Cl)ccc2Cl)CC(C)C)OC1=O |
| InChI | InChI=1S/C22H26BCl2NO8/c1-12(2)6-14(23-33-21(32)22(34-23,9-13(3)27)10-19(29)30)7-16(28)11-26-20(31)17-8-15(24)4-5-18(17)25/h4-5,8,12,14,27H,3,6-7,9-11H2,1-2H3,(H,26,31)(H,29,30)/t14-,22?/m1/s1 |
| InChIKey | IZVZPVZYQDQNFR-HNNQXCQYSA-N |
| XLogP | 3.84 |
| TPSA | 139.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.17 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|