C22H29BCl2N2O6 — CID 161079016
2,5-dichloro-N-[(4R)-6-methyl-2-oxo-4-[(5S,7S)-5,6,7-trimethyl-4,8-dioxo-1,3,6,2-dioxazaborocan-2-yl]heptyl]benzamide (PubChem CID 161079016) has the molecular formula C22H29BCl2N2O6 and a molecular weight of 499.20 g/mol. Its IUPAC name is 2,5-dichloro-N-[(4R)-6-methyl-2-oxo-4-[(5S,7S)-5,6,7-trimethyl-4,8-dioxo-1,3,6,2-dioxazaborocan-2-yl]heptyl]benzamide.
| Compound Name | 2,5-dichloro-N-[(4R)-6-methyl-2-oxo-4-[(5S,7S)-5,6,7-trimethyl-4,8-dioxo-1,3,6,2-dioxazaborocan-2-yl]heptyl]benzamide |
|---|---|
| PubChem CID | 161079016 |
| Molecular Formula | C22H29BCl2N2O6 |
| Molecular Weight | 499.20 g/mol |
| Exact Mass | 498.15 |
| IUPAC Name | 2,5-dichloro-N-[(4R)-6-methyl-2-oxo-4-[(5S,7S)-5,6,7-trimethyl-4,8-dioxo-1,3,6,2-dioxazaborocan-2-yl]heptyl]benzamide |
| SMILES | CC(C)C[C@H](CC(=O)CNC(=O)c1cc(Cl)ccc1Cl)B1OC(=O)[C@H](C)N(C)[C@@H](C)C(=O)O1 |
| InChI | InChI=1S/C22H29BCl2N2O6/c1-12(2)8-15(23-32-21(30)13(3)27(5)14(4)22(31)33-23)9-17(28)11-26-20(29)18-10-16(24)6-7-19(18)25/h6-7,10,12-15H,8-9,11H2,1-5H3,(H,26,29)/t13-,14-,15+/m0/s1 |
| InChIKey | UFQVFYGSXKGRBV-SOUVJXGZSA-N |
| XLogP | 3.40 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.20 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|