C24H32BCl2NO4 — CID 159764581
2,5-dichloro-N-[(4R)-4-[(2S,6R,8S)-9,9-dimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]-6-methyl-2-oxoheptyl]benzamide (PubChem CID 159764581) has the molecular formula C24H32BCl2NO4 and a molecular weight of 480.24 g/mol. Its IUPAC name is 2,5-dichloro-N-[(4R)-4-[(2S,6R,8S)-9,9-dimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]-6-methyl-2-oxoheptyl]benzamide.
| Compound Name | 2,5-dichloro-N-[(4R)-4-[(2S,6R,8S)-9,9-dimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]-6-methyl-2-oxoheptyl]benzamide |
|---|---|
| PubChem CID | 159764581 |
| Molecular Formula | C24H32BCl2NO4 |
| Molecular Weight | 480.24 g/mol |
| Exact Mass | 479.18 |
| IUPAC Name | 2,5-dichloro-N-[(4R)-4-[(2S,6R,8S)-9,9-dimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]-6-methyl-2-oxoheptyl]benzamide |
| SMILES | CC(C)C[C@H](CC(=O)CNC(=O)c1cc(Cl)ccc1Cl)B1O[C@@H]2C[C@@H]3CC([C@@H]2O1)C3(C)C |
| InChI | InChI=1S/C24H32BCl2NO4/c1-13(2)7-15(25-31-21-9-14-8-19(22(21)32-25)24(14,3)4)10-17(29)12-28-23(30)18-11-16(26)5-6-20(18)27/h5-6,11,13-15,19,21-22H,7-10,12H2,1-4H3,(H,28,30)/t14-,15+,19?,21+,22-/m0/s1 |
| InChIKey | RFRCPJULEONCHG-ZARLZGCBSA-N |
| XLogP | 5.44 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.24 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|