C22H22BClF3N3O5 — CID 163757720
N-[2-[[(1R)-1-(6-amino-4-oxo-1,3,2-benzodioxaborinin-2-yl)-3-methylbutyl]amino]-2-oxoethyl]-2-chloro-5-(trifluoromethyl)benzamide (PubChem CID 163757720) has the molecular formula C22H22BClF3N3O5 and a molecular weight of 511.69 g/mol. Its IUPAC name is N-[2-[[(1R)-1-(6-amino-4-oxo-1,3,2-benzodioxaborinin-2-yl)-3-methylbutyl]amino]-2-oxoethyl]-2-chloro-5-(trifluoromethyl)benzamide.
| Compound Name | N-[2-[[(1R)-1-(6-amino-4-oxo-1,3,2-benzodioxaborinin-2-yl)-3-methylbutyl]amino]-2-oxoethyl]-2-chloro-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 163757720 |
| Molecular Formula | C22H22BClF3N3O5 |
| Molecular Weight | 511.69 g/mol |
| Exact Mass | 511.13 |
| IUPAC Name | N-[2-[[(1R)-1-(6-amino-4-oxo-1,3,2-benzodioxaborinin-2-yl)-3-methylbutyl]amino]-2-oxoethyl]-2-chloro-5-(trifluoromethyl)benzamide |
| SMILES | CC(C)C[C@H](NC(=O)CNC(=O)c1cc(C(F)(F)F)ccc1Cl)B1OC(=O)c2cc(N)ccc2O1 |
| InChI | InChI=1S/C22H22BClF3N3O5/c1-11(2)7-18(23-34-17-6-4-13(28)9-15(17)21(33)35-23)30-19(31)10-29-20(32)14-8-12(22(25,26)27)3-5-16(14)24/h3-6,8-9,11,18H,7,10,28H2,1-2H3,(H,29,32)(H,30,31)/t18-/m0/s1 |
| InChIKey | LVMZZAGEAPATKI-SFHVURJKSA-N |
| XLogP | 3.48 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.69 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|