C11H11ClF3N3O2 — CID 175576668
5-amino-2-chloro-N-[2-oxo-2-(1,2,2-trifluoroethylamino)ethyl]benzamide (PubChem CID 175576668) has the molecular formula C11H11ClF3N3O2 and a molecular weight of 309.68 g/mol. Its IUPAC name is 5-amino-2-chloro-N-[2-oxo-2-(1,2,2-trifluoroethylamino)ethyl]benzamide.
| Compound Name | 5-amino-2-chloro-N-[2-oxo-2-(1,2,2-trifluoroethylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 175576668 |
| Molecular Formula | C11H11ClF3N3O2 |
| Molecular Weight | 309.68 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | 5-amino-2-chloro-N-[2-oxo-2-(1,2,2-trifluoroethylamino)ethyl]benzamide |
| SMILES | Nc1ccc(Cl)c(C(=O)NCC(=O)NC(F)C(F)F)c1 |
| InChI | InChI=1S/C11H11ClF3N3O2/c12-7-2-1-5(16)3-6(7)11(20)17-4-8(19)18-10(15)9(13)14/h1-3,9-10H,4,16H2,(H,17,20)(H,18,19) |
| InChIKey | DYOHUTPFHJHHGL-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.68 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|