C19H20ClN3O4 — CID 91300984
methyl 3-[2-[[2-[(5-amino-2-chlorobenzoyl)amino]acetyl]amino]phenyl]propanoate (PubChem CID 91300984) has the molecular formula C19H20ClN3O4 and a molecular weight of 389.84 g/mol. Its IUPAC name is methyl 3-[2-[[2-[(5-amino-2-chlorobenzoyl)amino]acetyl]amino]phenyl]propanoate.
| Compound Name | methyl 3-[2-[[2-[(5-amino-2-chlorobenzoyl)amino]acetyl]amino]phenyl]propanoate |
|---|---|
| PubChem CID | 91300984 |
| Molecular Formula | C19H20ClN3O4 |
| Molecular Weight | 389.84 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | methyl 3-[2-[[2-[(5-amino-2-chlorobenzoyl)amino]acetyl]amino]phenyl]propanoate |
| SMILES | COC(=O)CCc1ccccc1NC(=O)CNC(=O)c1cc(N)ccc1Cl |
| InChI | InChI=1S/C19H20ClN3O4/c1-27-18(25)9-6-12-4-2-3-5-16(12)23-17(24)11-22-19(26)14-10-13(21)7-8-15(14)20/h2-5,7-8,10H,6,9,11,21H2,1H3,(H,22,26)(H,23,24) |
| InChIKey | ZDJWAZXWRXJQBM-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.84 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|