C19H20ClN3O4 — CID 9078999
[2-[[2-(2-ethylanilino)-2-oxoethyl]amino]-2-oxoethyl] 3-amino-4-chlorobenzoate (PubChem CID 9078999) has the molecular formula C19H20ClN3O4 and a molecular weight of 389.84 g/mol. Its IUPAC name is [2-[[2-(2-ethylanilino)-2-oxoethyl]amino]-2-oxoethyl] 3-amino-4-chlorobenzoate.
| Compound Name | [2-[[2-(2-ethylanilino)-2-oxoethyl]amino]-2-oxoethyl] 3-amino-4-chlorobenzoate |
|---|---|
| PubChem CID | 9078999 |
| Molecular Formula | C19H20ClN3O4 |
| Molecular Weight | 389.84 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | [2-[[2-(2-ethylanilino)-2-oxoethyl]amino]-2-oxoethyl] 3-amino-4-chlorobenzoate |
| SMILES | CCc1ccccc1NC(=O)CNC(=O)COC(=O)c1ccc(Cl)c(N)c1 |
| InChI | InChI=1S/C19H20ClN3O4/c1-2-12-5-3-4-6-16(12)23-17(24)10-22-18(25)11-27-19(26)13-7-8-14(20)15(21)9-13/h3-9H,2,10-11,21H2,1H3,(H,22,25)(H,23,24) |
| InChIKey | XBVMRJGLVIXHLU-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.84 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|