C17H15F3N2O3 — CID 175422513
4-acetyl-N-[2-oxo-2-(1,2,2-trifluoroethylamino)ethyl]naphthalene-1-carboxamide (PubChem CID 175422513) has the molecular formula C17H15F3N2O3 and a molecular weight of 352.31 g/mol. Its IUPAC name is 4-acetyl-N-[2-oxo-2-(1,2,2-trifluoroethylamino)ethyl]naphthalene-1-carboxamide.
| Compound Name | 4-acetyl-N-[2-oxo-2-(1,2,2-trifluoroethylamino)ethyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 175422513 |
| Molecular Formula | C17H15F3N2O3 |
| Molecular Weight | 352.31 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | 4-acetyl-N-[2-oxo-2-(1,2,2-trifluoroethylamino)ethyl]naphthalene-1-carboxamide |
| SMILES | CC(=O)c1ccc(C(=O)NCC(=O)NC(F)C(F)F)c2ccccc12 |
| InChI | InChI=1S/C17H15F3N2O3/c1-9(23)10-6-7-13(12-5-3-2-4-11(10)12)17(25)21-8-14(24)22-16(20)15(18)19/h2-7,15-16H,8H2,1H3,(H,21,25)(H,22,24) |
| InChIKey | YNKLWGSPBBLZOR-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.31 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|