About 1-(4-ethylnaphthalen-1-yl)ethanone;1-(4-methylsulfanylnaphthalen-1-yl)ethanone
1-(4-ethylnaphthalen-1-yl)ethanone;1-(4-methylsulfanylnaphthalen-1-yl)ethanone (PubChem CID 161367210) has the molecular formula C27H26O2S
and a molecular weight of 414.57 g/mol. Its IUPAC name is 1-(4-ethylnaphthalen-1-yl)ethanone;1-(4-methylsulfanylnaphthalen-1-yl)ethanone.
Molecular Properties
| Compound Name | 1-(4-ethylnaphthalen-1-yl)ethanone;1-(4-methylsulfanylnaphthalen-1-yl)ethanone |
| PubChem CID | 161367210 |
| Molecular Formula | C27H26O2S |
| Molecular Weight | 414.57 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | 1-(4-ethylnaphthalen-1-yl)ethanone;1-(4-methylsulfanylnaphthalen-1-yl)ethanone |
| SMILES | CCc1ccc(C(C)=O)c2ccccc12.CSc1ccc(C(C)=O)c2ccccc12 |
| InChI | InChI=1S/C14H14O.C13H12OS/c1-3-11-8-9-12(10(2)15)14-7-5-4-6-13(11)14;1-9(14)10-7-8-13(15-2)12-6-4-3-5-11(10)12/h4-9H,3H2,1-2H3;3-8H,1-2H3 |
| InChIKey | VPYWVVNXJHKOOM-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 414.57 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(4-ethylnaphthalen-1-yl)ethanone;1-(4-methylsulfanylnaphthalen-1-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-ethylnaphthalen-1-yl)ethanone;1-(4-methylsulfanylnaphthalen-1-yl)ethanone?
The IUPAC name of 1-(4-ethylnaphthalen-1-yl)ethanone;1-(4-methylsulfanylnaphthalen-1-yl)ethanone (CID 161367210) is 1-(4-ethylnaphthalen-1-yl)ethanone;1-(4-methylsulfanylnaphthalen-1-yl)ethanone.
What is the SMILES notation for 1-(4-ethylnaphthalen-1-yl)ethanone;1-(4-methylsulfanylnaphthalen-1-yl)ethanone?
The canonical SMILES for 1-(4-ethylnaphthalen-1-yl)ethanone;1-(4-methylsulfanylnaphthalen-1-yl)ethanone is CCc1ccc(C(C)=O)c2ccccc12.CSc1ccc(C(C)=O)c2ccccc12.
What is the InChIKey of 1-(4-ethylnaphthalen-1-yl)ethanone;1-(4-methylsulfanylnaphthalen-1-yl)ethanone?
The InChIKey is VPYWVVNXJHKOOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14O.C13H12OS/c1-3-11-8-9-12(10(2)15)14-7-5-4-6-13(11)14;1-9(14)10-7-8-13(15-2)12-6-4-3-5-11(10)12/h4-9H,3H2,1-2H3;3-8H,1-2H3.
What are the key properties of 1-(4-ethylnaphthalen-1-yl)ethanone;1-(4-methylsulfanylnaphthalen-1-yl)ethanone?
1-(4-ethylnaphthalen-1-yl)ethanone;1-(4-methylsulfanylnaphthalen-1-yl)ethanone has a molecular weight of 414.57 g/mol, XLogP of 7.37, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-ethylnaphthalen-1-yl)ethanone;1-(4-methylsulfanylnaphthalen-1-yl)ethanone is sourced from PubChem (CID 161367210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).