C21H21BBr2N2O5 — CID 153048772
2,5-dibromo-N-[2-[[(1R)-3-methyl-1-(4-oxo-1,3,2-benzodioxaborinin-2-yl)butyl]amino]-2-oxoethyl]benzamide (PubChem CID 153048772) has the molecular formula C21H21BBr2N2O5 and a molecular weight of 552.03 g/mol. Its IUPAC name is 2,5-dibromo-N-[2-[[(1R)-3-methyl-1-(4-oxo-1,3,2-benzodioxaborinin-2-yl)butyl]amino]-2-oxoethyl]benzamide.
| Compound Name | 2,5-dibromo-N-[2-[[(1R)-3-methyl-1-(4-oxo-1,3,2-benzodioxaborinin-2-yl)butyl]amino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 153048772 |
| Molecular Formula | C21H21BBr2N2O5 |
| Molecular Weight | 552.03 g/mol |
| Exact Mass | 549.99 |
| IUPAC Name | 2,5-dibromo-N-[2-[[(1R)-3-methyl-1-(4-oxo-1,3,2-benzodioxaborinin-2-yl)butyl]amino]-2-oxoethyl]benzamide |
| SMILES | CC(C)C[C@H](NC(=O)CNC(=O)c1cc(Br)ccc1Br)B1OC(=O)c2ccccc2O1 |
| InChI | InChI=1S/C21H21BBr2N2O5/c1-12(2)9-18(22-30-17-6-4-3-5-14(17)21(29)31-22)26-19(27)11-25-20(28)15-10-13(23)7-8-16(15)24/h3-8,10,12,18H,9,11H2,1-2H3,(H,25,28)(H,26,27)/t18-/m0/s1 |
| InChIKey | VHDJCRWZONNQJV-SFHVURJKSA-N |
| XLogP | 3.75 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.03 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|