C20H30BBr2N3O4 — CID 145402645
2,5-dibromo-N-[2-[[(1R)-1-(1,3,7,2-dioxazaborecan-2-yl)-3-methylbutyl]amino]-2-oxoethyl]benzamide (PubChem CID 145402645) has the molecular formula C20H30BBr2N3O4 and a molecular weight of 547.10 g/mol. Its IUPAC name is 2,5-dibromo-N-[2-[[(1R)-1-(1,3,7,2-dioxazaborecan-2-yl)-3-methylbutyl]amino]-2-oxoethyl]benzamide.
| Compound Name | 2,5-dibromo-N-[2-[[(1R)-1-(1,3,7,2-dioxazaborecan-2-yl)-3-methylbutyl]amino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 145402645 |
| Molecular Formula | C20H30BBr2N3O4 |
| Molecular Weight | 547.10 g/mol |
| Exact Mass | 545.07 |
| IUPAC Name | 2,5-dibromo-N-[2-[[(1R)-1-(1,3,7,2-dioxazaborecan-2-yl)-3-methylbutyl]amino]-2-oxoethyl]benzamide |
| SMILES | CC(C)C[C@H](NC(=O)CNC(=O)c1cc(Br)ccc1Br)B1OCCCNCCCO1 |
| InChI | InChI=1S/C20H30BBr2N3O4/c1-14(2)11-18(21-29-9-3-7-24-8-4-10-30-21)26-19(27)13-25-20(28)16-12-15(22)5-6-17(16)23/h5-6,12,14,18,24H,3-4,7-11,13H2,1-2H3,(H,25,28)(H,26,27)/t18-/m0/s1 |
| InChIKey | GYYMYLVCUOHIPV-SFHVURJKSA-N |
| XLogP | 2.92 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.10 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|