C20H29BClF2N3O5 — CID 145402772
4-chloro-2,5-difluoro-N-[2-[[(1R)-1-[6-(2-hydroxyethyl)-1,3,6,2-dioxazaborocan-2-yl]-3-methylbutyl]amino]-2-oxoethyl]benzamide (PubChem CID 145402772) has the molecular formula C20H29BClF2N3O5 and a molecular weight of 475.73 g/mol. Its IUPAC name is 4-chloro-2,5-difluoro-N-[2-[[(1R)-1-[6-(2-hydroxyethyl)-1,3,6,2-dioxazaborocan-2-yl]-3-methylbutyl]amino]-2-oxoethyl]benzamide.
| Compound Name | 4-chloro-2,5-difluoro-N-[2-[[(1R)-1-[6-(2-hydroxyethyl)-1,3,6,2-dioxazaborocan-2-yl]-3-methylbutyl]amino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 145402772 |
| Molecular Formula | C20H29BClF2N3O5 |
| Molecular Weight | 475.73 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | 4-chloro-2,5-difluoro-N-[2-[[(1R)-1-[6-(2-hydroxyethyl)-1,3,6,2-dioxazaborocan-2-yl]-3-methylbutyl]amino]-2-oxoethyl]benzamide |
| SMILES | CC(C)C[C@H](NC(=O)CNC(=O)c1cc(F)c(Cl)cc1F)B1OCCN(CCO)CCO1 |
| InChI | InChI=1S/C20H29BClF2N3O5/c1-13(2)9-18(21-31-7-4-27(3-6-28)5-8-32-21)26-19(29)12-25-20(30)14-10-17(24)15(22)11-16(14)23/h10-11,13,18,28H,3-9,12H2,1-2H3,(H,25,30)(H,26,29)/t18-/m0/s1 |
| InChIKey | DTTSKCDPBXYPMF-SFHVURJKSA-N |
| XLogP | 1.25 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.73 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|