C14H15NO6 — CID 61152299
(2S)-2-(2,3-dihydro-1-benzofuran-5-carbonylamino)pentanedioic acid (PubChem CID 61152299) has the molecular formula C14H15NO6 and a molecular weight of 293.27 g/mol. Its IUPAC name is (2S)-2-(2,3-dihydro-1-benzofuran-5-carbonylamino)pentanedioic acid.
| Compound Name | (2S)-2-(2,3-dihydro-1-benzofuran-5-carbonylamino)pentanedioic acid |
|---|---|
| PubChem CID | 61152299 |
| Molecular Formula | C14H15NO6 |
| Molecular Weight | 293.27 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | (2S)-2-(2,3-dihydro-1-benzofuran-5-carbonylamino)pentanedioic acid |
| SMILES | O=C(O)CC[C@H](NC(=O)c1ccc2c(c1)CCO2)C(=O)O |
| InChI | InChI=1S/C14H15NO6/c16-12(17)4-2-10(14(19)20)15-13(18)9-1-3-11-8(7-9)5-6-21-11/h1,3,7,10H,2,4-6H2,(H,15,18)(H,16,17)(H,19,20)/t10-/m0/s1 |
| InChIKey | VLCPGJJLWDCZNR-JTQLQIEISA-N |
| XLogP | 0.67 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.27 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |