C13H13F3N2O5 — CID 177155034
(2R)-2-[[4-amino-2-(trifluoromethyl)benzoyl]amino]pentanedioic acid (PubChem CID 177155034) has the molecular formula C13H13F3N2O5 and a molecular weight of 334.25 g/mol. Its IUPAC name is (2R)-2-[[4-amino-2-(trifluoromethyl)benzoyl]amino]pentanedioic acid.
| Compound Name | (2R)-2-[[4-amino-2-(trifluoromethyl)benzoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 177155034 |
| Molecular Formula | C13H13F3N2O5 |
| Molecular Weight | 334.25 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | (2R)-2-[[4-amino-2-(trifluoromethyl)benzoyl]amino]pentanedioic acid |
| SMILES | Nc1ccc(C(=O)N[C@H](CCC(=O)O)C(=O)O)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H13F3N2O5/c14-13(15,16)8-5-6(17)1-2-7(8)11(21)18-9(12(22)23)3-4-10(19)20/h1-2,5,9H,3-4,17H2,(H,18,21)(H,19,20)(H,22,23)/t9-/m1/s1 |
| InChIKey | UPCDEHKIWGWZRG-SECBINFHSA-N |
| XLogP | 1.34 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.25 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|