C31H27Cl2NO4S — CID 56991986
methyl (2S)-3-[4-[(2,6-dichlorophenyl)methoxy]phenyl]-2-[[3-(4-methylphenyl)-2-sulfanylbenzoyl]amino]propanoate (PubChem CID 56991986) has the molecular formula C31H27Cl2NO4S and a molecular weight of 580.53 g/mol. Its IUPAC name is methyl (2S)-3-[4-[(2,6-dichlorophenyl)methoxy]phenyl]-2-[[3-(4-methylphenyl)-2-sulfanylbenzoyl]amino]propanoate.
| Compound Name | methyl (2S)-3-[4-[(2,6-dichlorophenyl)methoxy]phenyl]-2-[[3-(4-methylphenyl)-2-sulfanylbenzoyl]amino]propanoate |
|---|---|
| PubChem CID | 56991986 |
| Molecular Formula | C31H27Cl2NO4S |
| Molecular Weight | 580.53 g/mol |
| Exact Mass | 579.10 |
| IUPAC Name | methyl (2S)-3-[4-[(2,6-dichlorophenyl)methoxy]phenyl]-2-[[3-(4-methylphenyl)-2-sulfanylbenzoyl]amino]propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(OCc2c(Cl)cccc2Cl)cc1)NC(=O)c1cccc(-c2ccc(C)cc2)c1S |
| InChI | InChI=1S/C31H27Cl2NO4S/c1-19-9-13-21(14-10-19)23-5-3-6-24(29(23)39)30(35)34-28(31(36)37-2)17-20-11-15-22(16-12-20)38-18-25-26(32)7-4-8-27(25)33/h3-16,28,39H,17-18H2,1-2H3,(H,34,35)/t28-/m0/s1 |
| InChIKey | CVUCIPZJVGWELU-NDEPHWFRSA-N |
| XLogP | 7.35 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.53 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|