C23H19Cl3N2O4 — CID 22624506
methyl 2-[(2-chloropyridine-3-carbonyl)amino]-3-[3-[(2,6-dichlorophenyl)methoxy]phenyl]propanoate (PubChem CID 22624506) has the molecular formula C23H19Cl3N2O4 and a molecular weight of 493.77 g/mol. Its IUPAC name is methyl 2-[(2-chloropyridine-3-carbonyl)amino]-3-[3-[(2,6-dichlorophenyl)methoxy]phenyl]propanoate.
| Compound Name | methyl 2-[(2-chloropyridine-3-carbonyl)amino]-3-[3-[(2,6-dichlorophenyl)methoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 22624506 |
| Molecular Formula | C23H19Cl3N2O4 |
| Molecular Weight | 493.77 g/mol |
| Exact Mass | 492.04 |
| IUPAC Name | methyl 2-[(2-chloropyridine-3-carbonyl)amino]-3-[3-[(2,6-dichlorophenyl)methoxy]phenyl]propanoate |
| SMILES | COC(=O)C(Cc1cccc(OCc2c(Cl)cccc2Cl)c1)NC(=O)c1cccnc1Cl |
| InChI | InChI=1S/C23H19Cl3N2O4/c1-31-23(30)20(28-22(29)16-7-4-10-27-21(16)26)12-14-5-2-6-15(11-14)32-13-17-18(24)8-3-9-19(17)25/h2-11,20H,12-13H2,1H3,(H,28,29) |
| InChIKey | ITPJOBWQXMPQJE-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.77 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|