C20H18NO4- — CID 7618547
(2S,3R)-3-methyl-2-[(9-oxofluorene-4-carbonyl)amino]pentanoate (PubChem CID 7618547) has the molecular formula C20H18NO4- and a molecular weight of 336.37 g/mol. Its IUPAC name is (2S,3R)-3-methyl-2-[(9-oxofluorene-4-carbonyl)amino]pentanoate.
| Compound Name | (2S,3R)-3-methyl-2-[(9-oxofluorene-4-carbonyl)amino]pentanoate |
|---|---|
| PubChem CID | 7618547 |
| Molecular Formula | C20H18NO4- |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | (2S,3R)-3-methyl-2-[(9-oxofluorene-4-carbonyl)amino]pentanoate |
| SMILES | CC[C@@H](C)[C@H](NC(=O)c1cccc2c1-c1ccccc1C2=O)C(=O)[O-] |
| InChI | InChI=1S/C20H19NO4/c1-3-11(2)17(20(24)25)21-19(23)15-10-6-9-14-16(15)12-7-4-5-8-13(12)18(14)22/h4-11,17H,3H2,1-2H3,(H,21,23)(H,24,25)/p-1/t11-,17+/m1/s1 |
| InChIKey | KNERXKYUZIDBRX-DIFFPNOSSA-M |
| XLogP | 1.79 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |