C21H21N2O4- — CID 7618909
(2S,3R)-3-methyl-2-[(3-oxo-2-phenyl-1H-isoindole-4-carbonyl)amino]pentanoate (PubChem CID 7618909) has the molecular formula C21H21N2O4- and a molecular weight of 365.41 g/mol. Its IUPAC name is (2S,3R)-3-methyl-2-[(3-oxo-2-phenyl-1H-isoindole-4-carbonyl)amino]pentanoate.
| Compound Name | (2S,3R)-3-methyl-2-[(3-oxo-2-phenyl-1H-isoindole-4-carbonyl)amino]pentanoate |
|---|---|
| PubChem CID | 7618909 |
| Molecular Formula | C21H21N2O4- |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | (2S,3R)-3-methyl-2-[(3-oxo-2-phenyl-1H-isoindole-4-carbonyl)amino]pentanoate |
| SMILES | CC[C@@H](C)[C@H](NC(=O)c1cccc2c1C(=O)N(c1ccccc1)C2)C(=O)[O-] |
| InChI | InChI=1S/C21H22N2O4/c1-3-13(2)18(21(26)27)22-19(24)16-11-7-8-14-12-23(20(25)17(14)16)15-9-5-4-6-10-15/h4-11,13,18H,3,12H2,1-2H3,(H,22,24)(H,26,27)/p-1/t13-,18+/m1/s1 |
| InChIKey | YJGMCTQZQMPBKJ-ACJLOTCBSA-M |
| XLogP | 1.74 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |