C11H8N4O2S — CID 43152085
4-(5-nitro-1H-indol-3-yl)-1,3-thiazol-2-amine (PubChem CID 43152085) has the molecular formula C11H8N4O2S and a molecular weight of 260.28 g/mol. Its IUPAC name is 4-(5-nitro-1H-indol-3-yl)-1,3-thiazol-2-amine.
| Compound Name | 4-(5-nitro-1H-indol-3-yl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 43152085 |
| Molecular Formula | C11H8N4O2S |
| Molecular Weight | 260.28 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | 4-(5-nitro-1H-indol-3-yl)-1,3-thiazol-2-amine |
| SMILES | Nc1nc(-c2c[nH]c3ccc([N+](=O)[O-])cc23)cs1 |
| InChI | InChI=1S/C11H8N4O2S/c12-11-14-10(5-18-11)8-4-13-9-2-1-6(15(16)17)3-7(8)9/h1-5,13H,(H2,12,14) |
| InChIKey | JCMCZRHPVLBZSD-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 97.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.28 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|