C18H14N4O2 — CID 71299838
6,7-dimethyl-2-(5-nitro-1H-indol-3-yl)quinoxaline (PubChem CID 71299838) has the molecular formula C18H14N4O2 and a molecular weight of 318.34 g/mol. Its IUPAC name is 6,7-dimethyl-2-(5-nitro-1H-indol-3-yl)quinoxaline.
| Compound Name | 6,7-dimethyl-2-(5-nitro-1H-indol-3-yl)quinoxaline |
|---|---|
| PubChem CID | 71299838 |
| Molecular Formula | C18H14N4O2 |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 6,7-dimethyl-2-(5-nitro-1H-indol-3-yl)quinoxaline |
| SMILES | Cc1cc2ncc(-c3c[nH]c4ccc([N+](=O)[O-])cc34)nc2cc1C |
| InChI | InChI=1S/C18H14N4O2/c1-10-5-16-17(6-11(10)2)21-18(9-20-16)14-8-19-15-4-3-12(22(23)24)7-13(14)15/h3-9,19H,1-2H3 |
| InChIKey | HNNZXBQIPQCETR-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|