C15H7Cl2N3OS — CID 137269797
(Z)-2-(7-chloro-4-oxo-3H-quinazolin-2-yl)-3-(5-chlorothiophen-2-yl)prop-2-enenitrile (PubChem CID 137269797) has the molecular formula C15H7Cl2N3OS and a molecular weight of 348.21 g/mol. Its IUPAC name is (Z)-2-(7-chloro-4-oxo-3H-quinazolin-2-yl)-3-(5-chlorothiophen-2-yl)prop-2-enenitrile.
| Compound Name | (Z)-2-(7-chloro-4-oxo-3H-quinazolin-2-yl)-3-(5-chlorothiophen-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 137269797 |
| Molecular Formula | C15H7Cl2N3OS |
| Molecular Weight | 348.21 g/mol |
| Exact Mass | 346.97 |
| IUPAC Name | (Z)-2-(7-chloro-4-oxo-3H-quinazolin-2-yl)-3-(5-chlorothiophen-2-yl)prop-2-enenitrile |
| SMILES | N#C/C(=C/c1ccc(Cl)s1)c1nc2cc(Cl)ccc2c(=O)[nH]1 |
| InChI | InChI=1S/C15H7Cl2N3OS/c16-9-1-3-11-12(6-9)19-14(20-15(11)21)8(7-18)5-10-2-4-13(17)22-10/h1-6H,(H,19,20,21)/b8-5- |
| InChIKey | PPSYLOLWRBMCQK-YVMONPNESA-N |
| XLogP | 4.36 |
| TPSA | 69.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.21 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|