C23H22N6O3 — CID 135630440
(E)-3-[2-(4-ethylpiperazin-1-yl)-5-nitrophenyl]-2-(4-oxo-3H-quinazolin-2-yl)prop-2-enenitrile (PubChem CID 135630440) has the molecular formula C23H22N6O3 and a molecular weight of 430.47 g/mol. Its IUPAC name is (E)-3-[2-(4-ethylpiperazin-1-yl)-5-nitrophenyl]-2-(4-oxo-3H-quinazolin-2-yl)prop-2-enenitrile.
| Compound Name | (E)-3-[2-(4-ethylpiperazin-1-yl)-5-nitrophenyl]-2-(4-oxo-3H-quinazolin-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 135630440 |
| Molecular Formula | C23H22N6O3 |
| Molecular Weight | 430.47 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | (E)-3-[2-(4-ethylpiperazin-1-yl)-5-nitrophenyl]-2-(4-oxo-3H-quinazolin-2-yl)prop-2-enenitrile |
| SMILES | CCN1CCN(c2ccc([N+](=O)[O-])cc2/C=C(\C#N)c2nc3ccccc3c(=O)[nH]2)CC1 |
| InChI | InChI=1S/C23H22N6O3/c1-2-27-9-11-28(12-10-27)21-8-7-18(29(31)32)14-16(21)13-17(15-24)22-25-20-6-4-3-5-19(20)23(30)26-22/h3-8,13-14H,2,9-12H2,1H3,(H,25,26,30)/b17-13+ |
| InChIKey | CFIOXJWVNRYZKQ-GHRIWEEISA-N |
| XLogP | 3.04 |
| TPSA | 119.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.47 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|