C26H21ClN4O4 — CID 126395542
2-[2-chloro-4-[(Z)-2-cyano-2-(6-methoxy-1H-benzimidazol-2-yl)ethenyl]-6-methoxyphenoxy]-N-phenylacetamide (PubChem CID 126395542) has the molecular formula C26H21ClN4O4 and a molecular weight of 488.93 g/mol. Its IUPAC name is 2-[2-chloro-4-[(Z)-2-cyano-2-(6-methoxy-1H-benzimidazol-2-yl)ethenyl]-6-methoxyphenoxy]-N-phenylacetamide.
| Compound Name | 2-[2-chloro-4-[(Z)-2-cyano-2-(6-methoxy-1H-benzimidazol-2-yl)ethenyl]-6-methoxyphenoxy]-N-phenylacetamide |
|---|---|
| PubChem CID | 126395542 |
| Molecular Formula | C26H21ClN4O4 |
| Molecular Weight | 488.93 g/mol |
| Exact Mass | 488.13 |
| IUPAC Name | 2-[2-chloro-4-[(Z)-2-cyano-2-(6-methoxy-1H-benzimidazol-2-yl)ethenyl]-6-methoxyphenoxy]-N-phenylacetamide |
| SMILES | COc1ccc2nc(/C(C#N)=C\c3cc(Cl)c(OCC(=O)Nc4ccccc4)c(OC)c3)[nH]c2c1 |
| InChI | InChI=1S/C26H21ClN4O4/c1-33-19-8-9-21-22(13-19)31-26(30-21)17(14-28)10-16-11-20(27)25(23(12-16)34-2)35-15-24(32)29-18-6-4-3-5-7-18/h3-13H,15H2,1-2H3,(H,29,32)(H,30,31)/b17-10- |
| InChIKey | GPETYPWKOURJGO-YVLHZVERSA-N |
| XLogP | 5.32 |
| TPSA | 109.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.93 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|