C28H25BrN4O4 — CID 126397362
2-[2-bromo-4-[(Z)-2-cyano-2-(6-methoxy-1H-benzimidazol-2-yl)ethenyl]-6-ethoxyphenoxy]-N-(4-methylphenyl)acetamide (PubChem CID 126397362) has the molecular formula C28H25BrN4O4 and a molecular weight of 561.44 g/mol. Its IUPAC name is 2-[2-bromo-4-[(Z)-2-cyano-2-(6-methoxy-1H-benzimidazol-2-yl)ethenyl]-6-ethoxyphenoxy]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[2-bromo-4-[(Z)-2-cyano-2-(6-methoxy-1H-benzimidazol-2-yl)ethenyl]-6-ethoxyphenoxy]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126397362 |
| Molecular Formula | C28H25BrN4O4 |
| Molecular Weight | 561.44 g/mol |
| Exact Mass | 560.11 |
| IUPAC Name | 2-[2-bromo-4-[(Z)-2-cyano-2-(6-methoxy-1H-benzimidazol-2-yl)ethenyl]-6-ethoxyphenoxy]-N-(4-methylphenyl)acetamide |
| SMILES | CCOc1cc(/C=C(/C#N)c2nc3ccc(OC)cc3[nH]2)cc(Br)c1OCC(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C28H25BrN4O4/c1-4-36-25-13-18(11-19(15-30)28-32-23-10-9-21(35-3)14-24(23)33-28)12-22(29)27(25)37-16-26(34)31-20-7-5-17(2)6-8-20/h5-14H,4,16H2,1-3H3,(H,31,34)(H,32,33)/b19-11- |
| InChIKey | SESGNKKAOJXHTG-ODLFYWEKSA-N |
| XLogP | 6.12 |
| TPSA | 109.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.44 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|