C16H17ClN6O2 — CID 24582943
(E)-2-[4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enenitrile (PubChem CID 24582943) has the molecular formula C16H17ClN6O2 and a molecular weight of 360.81 g/mol. Its IUPAC name is (E)-2-[4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enenitrile.
| Compound Name | (E)-2-[4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 24582943 |
| Molecular Formula | C16H17ClN6O2 |
| Molecular Weight | 360.81 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | (E)-2-[4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enenitrile |
| SMILES | COc1cc(/C=C(\C#N)c2nc(N)nc(N(C)C)n2)cc(Cl)c1OC |
| InChI | InChI=1S/C16H17ClN6O2/c1-23(2)16-21-14(20-15(19)22-16)10(8-18)5-9-6-11(17)13(25-4)12(7-9)24-3/h5-7H,1-4H3,(H2,19,20,21,22)/b10-5+ |
| InChIKey | UETSPNJFVXBVEG-BJMVGYQFSA-N |
| XLogP | 2.25 |
| TPSA | 110.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.81 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|