C19H28O4S — CID 55328831
(4-tert-butylcyclohexyl) 4-(methylsulfonylmethyl)benzoate (PubChem CID 55328831) has the molecular formula C19H28O4S and a molecular weight of 352.50 g/mol. Its IUPAC name is (4-tert-butylcyclohexyl) 4-(methylsulfonylmethyl)benzoate.
| Compound Name | (4-tert-butylcyclohexyl) 4-(methylsulfonylmethyl)benzoate |
|---|---|
| PubChem CID | 55328831 |
| Molecular Formula | C19H28O4S |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | (4-tert-butylcyclohexyl) 4-(methylsulfonylmethyl)benzoate |
| SMILES | CC(C)(C)C1CCC(OC(=O)c2ccc(CS(C)(=O)=O)cc2)CC1 |
| InChI | InChI=1S/C19H28O4S/c1-19(2,3)16-9-11-17(12-10-16)23-18(20)15-7-5-14(6-8-15)13-24(4,21)22/h5-8,16-17H,9-13H2,1-4H3 |
| InChIKey | NMMJEJACPIJKQL-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |