C54H53NO12 — CID 10418295
[(2R,3S,4R,5S,6S)-5-amino-3,4-dibenzoyloxy-6-[(2R,3R,4R,5S,6S)-6-methyl-2,4,5-tris(phenylmethoxy)oxan-3-yl]oxyoxan-2-yl]methyl benzoate (PubChem CID 10418295) has the molecular formula C54H53NO12 and a molecular weight of 908.01 g/mol. Its IUPAC name is [(2R,3S,4R,5S,6S)-5-amino-3,4-dibenzoyloxy-6-[(2R,3R,4R,5S,6S)-6-methyl-2,4,5-tris(phenylmethoxy)oxan-3-yl]oxyoxan-2-yl]methyl benzoate.
| Compound Name | [(2R,3S,4R,5S,6S)-5-amino-3,4-dibenzoyloxy-6-[(2R,3R,4R,5S,6S)-6-methyl-2,4,5-tris(phenylmethoxy)oxan-3-yl]oxyoxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 10418295 |
| Molecular Formula | C54H53NO12 |
| Molecular Weight | 908.01 g/mol |
| Exact Mass | 907.36 |
| IUPAC Name | [(2R,3S,4R,5S,6S)-5-amino-3,4-dibenzoyloxy-6-[(2R,3R,4R,5S,6S)-6-methyl-2,4,5-tris(phenylmethoxy)oxan-3-yl]oxyoxan-2-yl]methyl benzoate |
| SMILES | C[C@@H]1O[C@@H](OCc2ccccc2)[C@H](O[C@@H]2O[C@H](COC(=O)c3ccccc3)[C@@H](OC(=O)c3ccccc3)[C@H](OC(=O)c3ccccc3)[C@@H]2N)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C54H53NO12/c1-36-45(59-32-37-20-8-2-9-21-37)48(60-33-38-22-10-3-11-23-38)49(54(63-36)62-34-39-24-12-4-13-25-39)67-53-44(55)47(66-52(58)42-30-18-7-19-31-42)46(65-51(57)41-28-16-6-17-29-41)43(64-53)35-61-50(56)40-26-14-5-15-27-40/h2-31,36,43-49,53-54H,32-35,55H2,1H3/t36-,43+,44-,45-,46+,47+,48+,49+,53-,54+/m0/s1 |
| InChIKey | VISKWELHCDGVLB-ANWVQGAKSA-N |
| XLogP | 7.86 |
| TPSA | 160.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 67 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 908.01 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|