C45H54O13 — CID 11297335
[(2R,3R,4S,5R,6S)-6-methoxy-4,5-bis(methoxymethoxy)-3-[(2S,3S,4R,5R,6S)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxyoxan-2-yl]methyl benzoate (PubChem CID 11297335) has the molecular formula C45H54O13 and a molecular weight of 802.91 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-6-methoxy-4,5-bis(methoxymethoxy)-3-[(2S,3S,4R,5R,6S)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxyoxan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4S,5R,6S)-6-methoxy-4,5-bis(methoxymethoxy)-3-[(2S,3S,4R,5R,6S)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxyoxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 11297335 |
| Molecular Formula | C45H54O13 |
| Molecular Weight | 802.91 g/mol |
| Exact Mass | 802.36 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-6-methoxy-4,5-bis(methoxymethoxy)-3-[(2S,3S,4R,5R,6S)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]oxyoxan-2-yl]methyl benzoate |
| SMILES | COCO[C@@H]1[C@@H](OCOC)[C@@H](OC)O[C@H](COC(=O)c2ccccc2)[C@H]1O[C@@H]1O[C@@H](C)[C@@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C45H54O13/c1-31-37(50-25-32-17-9-5-10-18-32)39(51-26-33-19-11-6-12-20-33)42(52-27-34-21-13-7-14-22-34)45(56-31)58-38-36(28-53-43(46)35-23-15-8-16-24-35)57-44(49-4)41(55-30-48-3)40(38)54-29-47-2/h5-24,31,36-42,44-45H,25-30H2,1-4H3/t31-,36+,37+,38+,39+,40-,41+,42-,44-,45-/m0/s1 |
| InChIKey | OMDFNCFOVWEHLN-VUJOOHLUSA-N |
| XLogP | 6.08 |
| TPSA | 127.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 802.91 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|