C34H33NO5 — CID 174151409
[(2R,4S,5R)-2-benzoyloxy-4-(dibenzylamino)-5-ethyloxolan-3-yl] benzoate (PubChem CID 174151409) has the molecular formula C34H33NO5 and a molecular weight of 535.64 g/mol. Its IUPAC name is [(2R,4S,5R)-2-benzoyloxy-4-(dibenzylamino)-5-ethyloxolan-3-yl] benzoate.
| Compound Name | [(2R,4S,5R)-2-benzoyloxy-4-(dibenzylamino)-5-ethyloxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 174151409 |
| Molecular Formula | C34H33NO5 |
| Molecular Weight | 535.64 g/mol |
| Exact Mass | 535.24 |
| IUPAC Name | [(2R,4S,5R)-2-benzoyloxy-4-(dibenzylamino)-5-ethyloxolan-3-yl] benzoate |
| SMILES | CC[C@H]1O[C@H](OC(=O)c2ccccc2)C(OC(=O)c2ccccc2)[C@H]1N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C34H33NO5/c1-2-29-30(35(23-25-15-7-3-8-16-25)24-26-17-9-4-10-18-26)31(39-32(36)27-19-11-5-12-20-27)34(38-29)40-33(37)28-21-13-6-14-22-28/h3-22,29-31,34H,2,23-24H2,1H3/t29-,30+,31?,34-/m1/s1 |
| InChIKey | ZCLXEKFKOKTWHG-PVHOEXIUSA-N |
| XLogP | 6.27 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.64 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |