C27H47N3O10 — CID 59172568
[(3R,5R,6S)-6-[(3R,5R,6R)-2-(acetyloxymethyl)-6-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]-4,5-dimethyloxan-3-yl]oxy-3,4,5-trimethyloxan-2-yl]methyl acetate (PubChem CID 59172568) has the molecular formula C27H47N3O10 and a molecular weight of 573.68 g/mol. Its IUPAC name is [(3R,5R,6S)-6-[(3R,5R,6R)-2-(acetyloxymethyl)-6-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]-4,5-dimethyloxan-3-yl]oxy-3,4,5-trimethyloxan-2-yl]methyl acetate.
| Compound Name | [(3R,5R,6S)-6-[(3R,5R,6R)-2-(acetyloxymethyl)-6-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]-4,5-dimethyloxan-3-yl]oxy-3,4,5-trimethyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 59172568 |
| Molecular Formula | C27H47N3O10 |
| Molecular Weight | 573.68 g/mol |
| Exact Mass | 573.33 |
| IUPAC Name | [(3R,5R,6S)-6-[(3R,5R,6R)-2-(acetyloxymethyl)-6-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]-4,5-dimethyloxan-3-yl]oxy-3,4,5-trimethyloxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1O[C@@H](O[C@H]2C(COC(C)=O)O[C@@H](OCCOCCOCCN=[N+]=[N-])[C@H](C)C2C)[C@H](C)C(C)[C@H]1C |
| InChI | InChI=1S/C27H47N3O10/c1-16-17(2)23(14-36-21(6)31)38-27(19(16)4)40-25-18(3)20(5)26(39-24(25)15-37-22(7)32)35-13-12-34-11-10-33-9-8-29-30-28/h16-20,23-27H,8-15H2,1-7H3/t16?,17-,18?,19-,20-,23?,24?,25-,26-,27+/m1/s1 |
| InChIKey | VJZYQECDTKNHTR-FMNRFVPLSA-N |
| XLogP | 3.49 |
| TPSA | 156.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.68 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|