C41H42O13 — CID 139994829
[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-[(4-hydroxy-2-phenoxyphenyl)methyl]-3-methyl-5-phenylmethoxyphenoxy]oxan-2-yl]methyl acetate (PubChem CID 139994829) has the molecular formula C41H42O13 and a molecular weight of 742.77 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-[(4-hydroxy-2-phenoxyphenyl)methyl]-3-methyl-5-phenylmethoxyphenoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-[(4-hydroxy-2-phenoxyphenyl)methyl]-3-methyl-5-phenylmethoxyphenoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 139994829 |
| Molecular Formula | C41H42O13 |
| Molecular Weight | 742.77 g/mol |
| Exact Mass | 742.26 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-[(4-hydroxy-2-phenoxyphenyl)methyl]-3-methyl-5-phenylmethoxyphenoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](Oc2cc(OCc3ccccc3)cc(C)c2Cc2ccc(O)cc2Oc2ccccc2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C41H42O13/c1-24-18-33(48-22-29-12-8-6-9-13-29)21-36(34(24)19-30-16-17-31(46)20-35(30)52-32-14-10-7-11-15-32)53-41-40(51-28(5)45)39(50-27(4)44)38(49-26(3)43)37(54-41)23-47-25(2)42/h6-18,20-21,37-41,46H,19,22-23H2,1-5H3/t37-,38-,39+,40-,41-/m1/s1 |
| InChIKey | ZXFJUCDCSFPTCA-PGSFLWIGSA-N |
| XLogP | 6.12 |
| TPSA | 162.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.77 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|