C40H48O12 — CID 166866367
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[2-[3,5-bis(phenylmethoxy)phenyl]ethoxy]oxan-2-yl]methyl 4-methylpentanoate (PubChem CID 166866367) has the molecular formula C40H48O12 and a molecular weight of 720.81 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[2-[3,5-bis(phenylmethoxy)phenyl]ethoxy]oxan-2-yl]methyl 4-methylpentanoate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[2-[3,5-bis(phenylmethoxy)phenyl]ethoxy]oxan-2-yl]methyl 4-methylpentanoate |
|---|---|
| PubChem CID | 166866367 |
| Molecular Formula | C40H48O12 |
| Molecular Weight | 720.81 g/mol |
| Exact Mass | 720.31 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[2-[3,5-bis(phenylmethoxy)phenyl]ethoxy]oxan-2-yl]methyl 4-methylpentanoate |
| SMILES | CC(=O)O[C@@H]1[C@@H](OC(C)=O)[C@H](OCCc2cc(OCc3ccccc3)cc(OCc3ccccc3)c2)O[C@H](COC(=O)CCC(C)C)[C@H]1OC(C)=O |
| InChI | InChI=1S/C40H48O12/c1-26(2)16-17-36(44)48-25-35-37(49-27(3)41)38(50-28(4)42)39(51-29(5)43)40(52-35)45-19-18-32-20-33(46-23-30-12-8-6-9-13-30)22-34(21-32)47-24-31-14-10-7-11-15-31/h6-15,20-22,26,35,37-40H,16-19,23-25H2,1-5H3/t35-,37-,38+,39-,40-/m1/s1 |
| InChIKey | ZKVBUIMKXIOMHE-HRSAFRLBSA-N |
| XLogP | 5.90 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.81 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|