C11H18O9 — CID 56940682
[(3S,6R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl (3R)-3,4-dihydroxy-2-methylidenebutanoate (PubChem CID 56940682) has the molecular formula C11H18O9 and a molecular weight of 294.26 g/mol. Its IUPAC name is [(3S,6R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl (3R)-3,4-dihydroxy-2-methylidenebutanoate.
| Compound Name | [(3S,6R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl (3R)-3,4-dihydroxy-2-methylidenebutanoate |
|---|---|
| PubChem CID | 56940682 |
| Molecular Formula | C11H18O9 |
| Molecular Weight | 294.26 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | [(3S,6R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl (3R)-3,4-dihydroxy-2-methylidenebutanoate |
| SMILES | C=C(C(=O)OCC1O[C@@H](O)C(O)C(O)[C@@H]1O)[C@@H](O)CO |
| InChI | InChI=1S/C11H18O9/c1-4(5(13)2-12)10(17)19-3-6-7(14)8(15)9(16)11(18)20-6/h5-9,11-16,18H,1-3H2/t5-,6?,7+,8?,9?,11+/m0/s1 |
| InChIKey | FMHJNIRDGYFPEC-WYFQEVEQSA-N |
| XLogP | -3.76 |
| TPSA | 156.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.26 |
| LogP ≤ 5 | -3.76 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|