C12H20O9 — CID 45104145
[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methyl (3R)-3,4-dihydroxy-2-methylidenebutanoate (PubChem CID 45104145) has the molecular formula C12H20O9 and a molecular weight of 308.28 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methyl (3R)-3,4-dihydroxy-2-methylidenebutanoate.
| Compound Name | [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methyl (3R)-3,4-dihydroxy-2-methylidenebutanoate |
|---|---|
| PubChem CID | 45104145 |
| Molecular Formula | C12H20O9 |
| Molecular Weight | 308.28 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methyl (3R)-3,4-dihydroxy-2-methylidenebutanoate |
| SMILES | C=C(C(=O)OC[C@H]1O[C@H](OC)[C@H](O)[C@@H](O)[C@@H]1O)[C@@H](O)CO |
| InChI | InChI=1S/C12H20O9/c1-5(6(14)3-13)11(18)20-4-7-8(15)9(16)10(17)12(19-2)21-7/h6-10,12-17H,1,3-4H2,2H3/t6-,7+,8+,9-,10+,12-/m0/s1 |
| InChIKey | DLQSNOKYUUMSHR-BZKDFATFSA-N |
| XLogP | -3.11 |
| TPSA | 145.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.28 |
| LogP ≤ 5 | -3.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|