C12H21NO8 — CID 101135670
[(2R,3S,4S,5S,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methyl (2S)-2-acetamidopropanoate (PubChem CID 101135670) has the molecular formula C12H21NO8 and a molecular weight of 307.30 g/mol. Its IUPAC name is [(2R,3S,4S,5S,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methyl (2S)-2-acetamidopropanoate.
| Compound Name | [(2R,3S,4S,5S,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methyl (2S)-2-acetamidopropanoate |
|---|---|
| PubChem CID | 101135670 |
| Molecular Formula | C12H21NO8 |
| Molecular Weight | 307.30 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | [(2R,3S,4S,5S,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methyl (2S)-2-acetamidopropanoate |
| SMILES | CO[C@H]1O[C@H](COC(=O)[C@H](C)NC(C)=O)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H21NO8/c1-5(13-6(2)14)11(18)20-4-7-8(15)9(16)10(17)12(19-3)21-7/h5,7-10,12,15-17H,4H2,1-3H3,(H,13,14)/t5-,7+,8+,9-,10-,12-/m0/s1 |
| InChIKey | CBFNDAYHHUVIRN-WJXLBQDMSA-N |
| XLogP | -2.49 |
| TPSA | 134.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.30 |
| LogP ≤ 5 | -2.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |