C7H13O6P — CID 58178598
(2R,3R,4S,5S,6S)-2-methoxy-6-(phosphorosomethyl)oxane-3,4,5-triol (PubChem CID 58178598) has the molecular formula C7H13O6P and a molecular weight of 224.15 g/mol. Its IUPAC name is (2R,3R,4S,5S,6S)-2-methoxy-6-(phosphorosomethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6S)-2-methoxy-6-(phosphorosomethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 58178598 |
| Molecular Formula | C7H13O6P |
| Molecular Weight | 224.15 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | (2R,3R,4S,5S,6S)-2-methoxy-6-(phosphorosomethyl)oxane-3,4,5-triol |
| SMILES | CO[C@@H]1O[C@H](CP=O)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C7H13O6P/c1-12-7-6(10)5(9)4(8)3(13-7)2-14-11/h3-10H,2H2,1H3/t3-,4-,5+,6-,7-/m1/s1 |
| InChIKey | LHQKIDMCZFJASQ-XUUWZHRGSA-N |
| XLogP | -1.27 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.15 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|