C21H24O8 — CID 138733206
[(2R,3S,4S,5R,6R)-3,4,6-trihydroxy-5-methoxyoxan-2-yl]methyl 2-methyl-4-phenoxybenzoate (PubChem CID 138733206) has the molecular formula C21H24O8 and a molecular weight of 404.42 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-3,4,6-trihydroxy-5-methoxyoxan-2-yl]methyl 2-methyl-4-phenoxybenzoate.
| Compound Name | [(2R,3S,4S,5R,6R)-3,4,6-trihydroxy-5-methoxyoxan-2-yl]methyl 2-methyl-4-phenoxybenzoate |
|---|---|
| PubChem CID | 138733206 |
| Molecular Formula | C21H24O8 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-3,4,6-trihydroxy-5-methoxyoxan-2-yl]methyl 2-methyl-4-phenoxybenzoate |
| SMILES | CO[C@@H]1[C@@H](O)[C@H](O)[C@@H](COC(=O)c2ccc(Oc3ccccc3)cc2C)O[C@H]1O |
| InChI | InChI=1S/C21H24O8/c1-12-10-14(28-13-6-4-3-5-7-13)8-9-15(12)20(24)27-11-16-17(22)18(23)19(26-2)21(25)29-16/h3-10,16-19,21-23,25H,11H2,1-2H3/t16-,17-,18+,19-,21-/m1/s1 |
| InChIKey | VUZNSEZSWYAVSF-GQUPQBGVSA-N |
| XLogP | 1.40 |
| TPSA | 114.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |