C17H26O5 — CID 132850641
[(2R,3S,4S,5R,6S)-6-(hydroxymethyl)-6-methoxy-3,5-dimethyl-4-phenylmethoxyoxan-2-yl]methanol (PubChem CID 132850641) has the molecular formula C17H26O5 and a molecular weight of 310.39 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-6-(hydroxymethyl)-6-methoxy-3,5-dimethyl-4-phenylmethoxyoxan-2-yl]methanol.
| Compound Name | [(2R,3S,4S,5R,6S)-6-(hydroxymethyl)-6-methoxy-3,5-dimethyl-4-phenylmethoxyoxan-2-yl]methanol |
|---|---|
| PubChem CID | 132850641 |
| Molecular Formula | C17H26O5 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-6-(hydroxymethyl)-6-methoxy-3,5-dimethyl-4-phenylmethoxyoxan-2-yl]methanol |
| SMILES | CO[C@]1(CO)O[C@@H](CO)[C@@H](C)[C@H](OCc2ccccc2)[C@H]1C |
| InChI | InChI=1S/C17H26O5/c1-12-15(9-18)22-17(11-19,20-3)13(2)16(12)21-10-14-7-5-4-6-8-14/h4-8,12-13,15-16,18-19H,9-11H2,1-3H3/t12-,13-,15+,16+,17-/m1/s1 |
| InChIKey | MZVLAYHASMOAHW-DRANZPFZSA-N |
| XLogP | 1.57 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |