C33H33NO5S — CID 177442623
(2S,3R,4R,5S)-N-(2-methylsulfanylphenyl)-3,4,5-tris(phenylmethoxy)oxolane-2-carboxamide (PubChem CID 177442623) has the molecular formula C33H33NO5S and a molecular weight of 555.70 g/mol. Its IUPAC name is (2S,3R,4R,5S)-N-(2-methylsulfanylphenyl)-3,4,5-tris(phenylmethoxy)oxolane-2-carboxamide.
| Compound Name | (2S,3R,4R,5S)-N-(2-methylsulfanylphenyl)-3,4,5-tris(phenylmethoxy)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 177442623 |
| Molecular Formula | C33H33NO5S |
| Molecular Weight | 555.70 g/mol |
| Exact Mass | 555.21 |
| IUPAC Name | (2S,3R,4R,5S)-N-(2-methylsulfanylphenyl)-3,4,5-tris(phenylmethoxy)oxolane-2-carboxamide |
| SMILES | CSc1ccccc1NC(=O)[C@H]1O[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C33H33NO5S/c1-40-28-20-12-11-19-27(28)34-32(35)30-29(36-21-24-13-5-2-6-14-24)31(37-22-25-15-7-3-8-16-25)33(39-30)38-23-26-17-9-4-10-18-26/h2-20,29-31,33H,21-23H2,1H3,(H,34,35)/t29-,30-,31+,33-/m0/s1 |
| InChIKey | GTTAKSHAXYBNHW-YUPAOTDASA-N |
| XLogP | 6.46 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.70 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |