C12H15NO5S — CID 121405173
[(3R)-5-oxomorpholin-3-yl]methyl 4-methylbenzenesulfonate (PubChem CID 121405173) has the molecular formula C12H15NO5S and a molecular weight of 285.32 g/mol. Its IUPAC name is [(3R)-5-oxomorpholin-3-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(3R)-5-oxomorpholin-3-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 121405173 |
| Molecular Formula | C12H15NO5S |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | [(3R)-5-oxomorpholin-3-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@H]2COCC(=O)N2)cc1 |
| InChI | InChI=1S/C12H15NO5S/c1-9-2-4-11(5-3-9)19(15,16)18-7-10-6-17-8-12(14)13-10/h2-5,10H,6-8H2,1H3,(H,13,14)/t10-/m1/s1 |
| InChIKey | HDGQSHPUGAJPKD-SNVBAGLBSA-N |
| XLogP | 0.22 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|