About (2-methylidenecyclopropyl)methyl 3-nitrobenzenesulfonate
(2-methylidenecyclopropyl)methyl 3-nitrobenzenesulfonate (PubChem CID 89302560) has the molecular formula C11H11NO5S
and a molecular weight of 269.28 g/mol. Its IUPAC name is (2-methylidenecyclopropyl)methyl 3-nitrobenzenesulfonate.
Molecular Properties
| Compound Name | (2-methylidenecyclopropyl)methyl 3-nitrobenzenesulfonate |
| PubChem CID | 89302560 |
| Molecular Formula | C11H11NO5S |
| Molecular Weight | 269.28 g/mol |
| Exact Mass | 269.04 |
| IUPAC Name | (2-methylidenecyclopropyl)methyl 3-nitrobenzenesulfonate |
| SMILES | C=C1CC1COS(=O)(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H11NO5S/c1-8-5-9(8)7-17-18(15,16)11-4-2-3-10(6-11)12(13)14/h2-4,6,9H,1,5,7H2 |
| InChIKey | WBABGSMAIMCJQJ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.28 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (2-methylidenecyclopropyl)methyl 3-nitrobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methylidenecyclopropyl)methyl 3-nitrobenzenesulfonate?
The IUPAC name of (2-methylidenecyclopropyl)methyl 3-nitrobenzenesulfonate (CID 89302560) is (2-methylidenecyclopropyl)methyl 3-nitrobenzenesulfonate.
What is the SMILES notation for (2-methylidenecyclopropyl)methyl 3-nitrobenzenesulfonate?
The canonical SMILES for (2-methylidenecyclopropyl)methyl 3-nitrobenzenesulfonate is C=C1CC1COS(=O)(=O)c1cccc([N+](=O)[O-])c1.
What is the InChIKey of (2-methylidenecyclopropyl)methyl 3-nitrobenzenesulfonate?
The InChIKey is WBABGSMAIMCJQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO5S/c1-8-5-9(8)7-17-18(15,16)11-4-2-3-10(6-11)12(13)14/h2-4,6,9H,1,5,7H2.
What are the key properties of (2-methylidenecyclopropyl)methyl 3-nitrobenzenesulfonate?
(2-methylidenecyclopropyl)methyl 3-nitrobenzenesulfonate has a molecular weight of 269.28 g/mol, XLogP of 1.88, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methylidenecyclopropyl)methyl 3-nitrobenzenesulfonate is sourced from PubChem (CID 89302560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).