About [(2S)-2-ethyloxiran-2-yl]methyl 3-nitrobenzenesulfonate
[(2S)-2-ethyloxiran-2-yl]methyl 3-nitrobenzenesulfonate (PubChem CID 87780645) has the molecular formula C11H13NO6S
and a molecular weight of 287.29 g/mol. Its IUPAC name is [(2S)-2-ethyloxiran-2-yl]methyl 3-nitrobenzenesulfonate.
Molecular Properties
| Compound Name | [(2S)-2-ethyloxiran-2-yl]methyl 3-nitrobenzenesulfonate |
| PubChem CID | 87780645 |
| Molecular Formula | C11H13NO6S |
| Molecular Weight | 287.29 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | [(2S)-2-ethyloxiran-2-yl]methyl 3-nitrobenzenesulfonate |
| SMILES | CC[C@@]1(COS(=O)(=O)c2cccc([N+](=O)[O-])c2)CO1 |
| InChI | InChI=1S/C11H13NO6S/c1-2-11(7-17-11)8-18-19(15,16)10-5-3-4-9(6-10)12(13)14/h3-6H,2,7-8H2,1H3/t11-/m0/s1 |
| InChIKey | VNAKHHOHJULPEK-NSHDSACASA-N |
| XLogP | 1.48 |
| TPSA | 99.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.29 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze [(2S)-2-ethyloxiran-2-yl]methyl 3-nitrobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-2-ethyloxiran-2-yl]methyl 3-nitrobenzenesulfonate?
The IUPAC name of [(2S)-2-ethyloxiran-2-yl]methyl 3-nitrobenzenesulfonate (CID 87780645) is [(2S)-2-ethyloxiran-2-yl]methyl 3-nitrobenzenesulfonate.
What is the SMILES notation for [(2S)-2-ethyloxiran-2-yl]methyl 3-nitrobenzenesulfonate?
The canonical SMILES for [(2S)-2-ethyloxiran-2-yl]methyl 3-nitrobenzenesulfonate is CC[C@@]1(COS(=O)(=O)c2cccc([N+](=O)[O-])c2)CO1.
What is the InChIKey of [(2S)-2-ethyloxiran-2-yl]methyl 3-nitrobenzenesulfonate?
The InChIKey is VNAKHHOHJULPEK-NSHDSACASA-N. The full InChI is InChI=1S/C11H13NO6S/c1-2-11(7-17-11)8-18-19(15,16)10-5-3-4-9(6-10)12(13)14/h3-6H,2,7-8H2,1H3/t11-/m0/s1.
What are the key properties of [(2S)-2-ethyloxiran-2-yl]methyl 3-nitrobenzenesulfonate?
[(2S)-2-ethyloxiran-2-yl]methyl 3-nitrobenzenesulfonate has a molecular weight of 287.29 g/mol, XLogP of 1.48, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-2-ethyloxiran-2-yl]methyl 3-nitrobenzenesulfonate is sourced from PubChem (CID 87780645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).