C12H10N2O6S — CID 175571187
1,3-oxazepin-2-ylmethyl 3-nitrobenzenesulfonate (PubChem CID 175571187) has the molecular formula C12H10N2O6S and a molecular weight of 310.29 g/mol. Its IUPAC name is 1,3-oxazepin-2-ylmethyl 3-nitrobenzenesulfonate.
| Compound Name | 1,3-oxazepin-2-ylmethyl 3-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 175571187 |
| Molecular Formula | C12H10N2O6S |
| Molecular Weight | 310.29 g/mol |
| Exact Mass | 310.03 |
| IUPAC Name | 1,3-oxazepin-2-ylmethyl 3-nitrobenzenesulfonate |
| SMILES | O=[N+]([O-])c1cccc(S(=O)(=O)OCC2=NC=CC=CO2)c1 |
| InChI | InChI=1S/C12H10N2O6S/c15-14(16)10-4-3-5-11(8-10)21(17,18)20-9-12-13-6-1-2-7-19-12/h1-8H,9H2 |
| InChIKey | SXLXNXJWAJBAAC-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 108.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.29 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|