C12H15NO7S — CID 10734370
[(4S)-2,2-dimethyl-(514C)1,3-dioxolan-4-yl]methyl 3-nitrobenzenesulfonate (PubChem CID 10734370) has the molecular formula C12H15NO7S and a molecular weight of 319.31 g/mol. Its IUPAC name is [(4S)-2,2-dimethyl-(514C)1,3-dioxolan-4-yl]methyl 3-nitrobenzenesulfonate.
| Compound Name | [(4S)-2,2-dimethyl-(514C)1,3-dioxolan-4-yl]methyl 3-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 10734370 |
| Molecular Formula | C12H15NO7S |
| Molecular Weight | 319.31 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | [(4S)-2,2-dimethyl-(514C)1,3-dioxolan-4-yl]methyl 3-nitrobenzenesulfonate |
| SMILES | CC1(C)O[14CH2][C@@H](COS(=O)(=O)c2cccc([N+](=O)[O-])c2)O1 |
| InChI | InChI=1S/C12H15NO7S/c1-12(2)18-7-10(20-12)8-19-21(16,17)11-5-3-4-9(6-11)13(14)15/h3-6,10H,7-8H2,1-2H3/t10-/m0/s1/i7+2 |
| InChIKey | XTKRMEWSVVGITM-VJKGKTCBSA-N |
| XLogP | 1.45 |
| TPSA | 104.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.31 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|